C24H30O3 — CID 101437820
[(4S)-dec-1-yn-4-yl] (2R)-2-methoxy-2-naphthalen-1-ylpropanoate (PubChem CID 101437820) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is [(4S)-dec-1-yn-4-yl] (2R)-2-methoxy-2-naphthalen-1-ylpropanoate.
| Compound Name | [(4S)-dec-1-yn-4-yl] (2R)-2-methoxy-2-naphthalen-1-ylpropanoate |
|---|---|
| PubChem CID | 101437820 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | [(4S)-dec-1-yn-4-yl] (2R)-2-methoxy-2-naphthalen-1-ylpropanoate |
| SMILES | C#CC[C@H](CCCCCC)OC(=O)[C@](C)(OC)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H30O3/c1-5-7-8-9-16-20(13-6-2)27-23(25)24(3,26-4)22-18-12-15-19-14-10-11-17-21(19)22/h2,10-12,14-15,17-18,20H,5,7-9,13,16H2,1,3-4H3/t20-,24-/m1/s1 |
| InChIKey | XXDKLNIZOFGEHD-HYBUGGRVSA-N |
| XLogP | 5.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|