C33H50O4 — CID 102393098
2-oxononadecan-10-yl (2S)-2-methoxy-2-naphthalen-1-ylpropanoate (PubChem CID 102393098) has the molecular formula C33H50O4 and a molecular weight of 510.76 g/mol. Its IUPAC name is 2-oxononadecan-10-yl (2S)-2-methoxy-2-naphthalen-1-ylpropanoate.
| Compound Name | 2-oxononadecan-10-yl (2S)-2-methoxy-2-naphthalen-1-ylpropanoate |
|---|---|
| PubChem CID | 102393098 |
| Molecular Formula | C33H50O4 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | 2-oxononadecan-10-yl (2S)-2-methoxy-2-naphthalen-1-ylpropanoate |
| SMILES | CCCCCCCCCC(CCCCCCCC(C)=O)OC(=O)[C@@](C)(OC)c1cccc2ccccc12 |
| InChI | InChI=1S/C33H50O4/c1-5-6-7-8-9-12-15-23-29(24-16-13-10-11-14-20-27(2)34)37-32(35)33(3,36-4)31-26-19-22-28-21-17-18-25-30(28)31/h17-19,21-22,25-26,29H,5-16,20,23-24H2,1-4H3/t29?,33-/m0/s1 |
| InChIKey | LQMDFCVVDUKRAP-CJEZNJPTSA-N |
| XLogP | 9.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|