C27H23ClO3 — CID 102381389
[(2-chlorophenyl)-phenylmethyl] (2S)-2-methoxy-2-naphthalen-1-ylpropanoate (PubChem CID 102381389) has the molecular formula C27H23ClO3 and a molecular weight of 430.93 g/mol. Its IUPAC name is [(2-chlorophenyl)-phenylmethyl] (2S)-2-methoxy-2-naphthalen-1-ylpropanoate.
| Compound Name | [(2-chlorophenyl)-phenylmethyl] (2S)-2-methoxy-2-naphthalen-1-ylpropanoate |
|---|---|
| PubChem CID | 102381389 |
| Molecular Formula | C27H23ClO3 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | [(2-chlorophenyl)-phenylmethyl] (2S)-2-methoxy-2-naphthalen-1-ylpropanoate |
| SMILES | CO[C@](C)(C(=O)OC(c1ccccc1)c1ccccc1Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H23ClO3/c1-27(30-2,23-17-10-14-19-11-6-7-15-21(19)23)26(29)31-25(20-12-4-3-5-13-20)22-16-8-9-18-24(22)28/h3-18,25H,1-2H3/t25?,27-/m0/s1 |
| InChIKey | SAUTXOOXJBIWJH-GPNIZQGCSA-N |
| XLogP | 6.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |