C29H38O3 — CID 119080188
[(1S,2E,6Z)-1-deuterio-3,7,11-trimethyldodeca-2,6,10-trienyl] (2S)-2-methoxy-2-naphthalen-1-ylpropanoate (PubChem CID 119080188) has the molecular formula C29H38O3 and a molecular weight of 435.63 g/mol. Its IUPAC name is [(1S,2E,6Z)-1-deuterio-3,7,11-trimethyldodeca-2,6,10-trienyl] (2S)-2-methoxy-2-naphthalen-1-ylpropanoate.
| Compound Name | [(1S,2E,6Z)-1-deuterio-3,7,11-trimethyldodeca-2,6,10-trienyl] (2S)-2-methoxy-2-naphthalen-1-ylpropanoate |
|---|---|
| PubChem CID | 119080188 |
| Molecular Formula | C29H38O3 |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | [(1S,2E,6Z)-1-deuterio-3,7,11-trimethyldodeca-2,6,10-trienyl] (2S)-2-methoxy-2-naphthalen-1-ylpropanoate |
| SMILES | [2H][C@@H](/C=C(\C)CC/C=C(/C)CCC=C(C)C)OC(=O)[C@@](C)(OC)c1cccc2ccccc12 |
| InChI | InChI=1S/C29H38O3/c1-22(2)12-9-13-23(3)14-10-15-24(4)20-21-32-28(30)29(5,31-6)27-19-11-17-25-16-7-8-18-26(25)27/h7-8,11-12,14,16-20H,9-10,13,15,21H2,1-6H3/b23-14-,24-20+/t29-/m0/s1/i21D/t21-,29- |
| InChIKey | FRJISJCTFRXJHZ-KBXALDLESA-N |
| XLogP | 7.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|