C23H34O3 — CID 11739851
[(3S,6E)-3-hydroxy-3,7,11-trimethyldodeca-6,10-dienyl] 2-phenylacetate (PubChem CID 11739851) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is [(3S,6E)-3-hydroxy-3,7,11-trimethyldodeca-6,10-dienyl] 2-phenylacetate.
| Compound Name | [(3S,6E)-3-hydroxy-3,7,11-trimethyldodeca-6,10-dienyl] 2-phenylacetate |
|---|---|
| PubChem CID | 11739851 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | [(3S,6E)-3-hydroxy-3,7,11-trimethyldodeca-6,10-dienyl] 2-phenylacetate |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@](C)(O)CCOC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H34O3/c1-19(2)10-8-11-20(3)12-9-15-23(4,25)16-17-26-22(24)18-21-13-6-5-7-14-21/h5-7,10,12-14,25H,8-9,11,15-18H2,1-4H3/b20-12+/t23-/m0/s1 |
| InChIKey | ARYMURCPWLICFV-AGIMELGASA-N |
| XLogP | 5.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|