C21H32BrNO2 — CID 140987342
[(2E)-3,7-dimethylocta-2,6-dienoxy]carbonyl-dimethyl-(2-phenylethyl)azanium bromide (PubChem CID 140987342) has the molecular formula C21H32BrNO2 and a molecular weight of 410.40 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienoxy]carbonyl-dimethyl-(2-phenylethyl)azanium bromide.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienoxy]carbonyl-dimethyl-(2-phenylethyl)azanium bromide |
|---|---|
| PubChem CID | 140987342 |
| Molecular Formula | C21H32BrNO2 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienoxy]carbonyl-dimethyl-(2-phenylethyl)azanium bromide |
| SMILES | CC(C)=CCC/C(C)=C/COC(=O)[N+](C)(C)CCc1ccccc1.[Br-] |
| InChI | InChI=1S/C21H32NO2.BrH/c1-18(2)10-9-11-19(3)15-17-24-21(23)22(4,5)16-14-20-12-7-6-8-13-20;/h6-8,10,12-13,15H,9,11,14,16-17H2,1-5H3;1H/q+1;/p-1/b19-15+; |
| InChIKey | JRXVMUKWXSRJEO-QTCZRQAZSA-M |
| XLogP | 2.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|