C19H28O — CID 71663930
(5E)-6,10-dimethyl-1-phenylundeca-5,9-dien-4-ol (PubChem CID 71663930) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is (5E)-6,10-dimethyl-1-phenylundeca-5,9-dien-4-ol.
| Compound Name | (5E)-6,10-dimethyl-1-phenylundeca-5,9-dien-4-ol |
|---|---|
| PubChem CID | 71663930 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (5E)-6,10-dimethyl-1-phenylundeca-5,9-dien-4-ol |
| SMILES | CC(C)=CCC/C(C)=C/C(O)CCCc1ccccc1 |
| InChI | InChI=1S/C19H28O/c1-16(2)9-7-10-17(3)15-19(20)14-8-13-18-11-5-4-6-12-18/h4-6,9,11-12,15,19-20H,7-8,10,13-14H2,1-3H3/b17-15+ |
| InChIKey | HYCGKRGLCVRBJP-BMRADRMJSA-N |
| XLogP | 5.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|