C27H40O — CID 70359002
[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]oxymethylbenzene (PubChem CID 70359002) has the molecular formula C27H40O and a molecular weight of 380.62 g/mol. Its IUPAC name is [(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]oxymethylbenzene.
| Compound Name | [(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 70359002 |
| Molecular Formula | C27H40O |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | [(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]oxymethylbenzene |
| SMILES | CC(C)=CCC/C(C)=C/CC(/C=C(\C)CCC=C(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C27H40O/c1-22(2)12-10-14-24(5)18-19-27(20-25(6)15-11-13-23(3)4)28-21-26-16-8-7-9-17-26/h7-9,12-13,16-18,20,27H,10-11,14-15,19,21H2,1-6H3/b24-18+,25-20+ |
| InChIKey | KLLQLPZIJAUYNI-OQAQWEHRSA-N |
| XLogP | 8.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|