C19H26O2S — CID 11758966
[(3E)-4,8-dimethyl-1-phenylsulfanylnona-3,7-dien-2-yl] acetate (PubChem CID 11758966) has the molecular formula C19H26O2S and a molecular weight of 318.48 g/mol. Its IUPAC name is [(3E)-4,8-dimethyl-1-phenylsulfanylnona-3,7-dien-2-yl] acetate.
| Compound Name | [(3E)-4,8-dimethyl-1-phenylsulfanylnona-3,7-dien-2-yl] acetate |
|---|---|
| PubChem CID | 11758966 |
| Molecular Formula | C19H26O2S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | [(3E)-4,8-dimethyl-1-phenylsulfanylnona-3,7-dien-2-yl] acetate |
| SMILES | CC(=O)OC(/C=C(\C)CCC=C(C)C)CSc1ccccc1 |
| InChI | InChI=1S/C19H26O2S/c1-15(2)9-8-10-16(3)13-18(21-17(4)20)14-22-19-11-6-5-7-12-19/h5-7,9,11-13,18H,8,10,14H2,1-4H3/b16-13+ |
| InChIKey | DTTZYLROSUIGGA-DTQAZKPQSA-N |
| XLogP | 5.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|