C27H38O3 — CID 11058683
[(4R,5E,9E)-6,10,14-trimethylpentadeca-1,5,9,13-tetraen-4-yl] (2S)-2-methoxy-2-phenylacetate (PubChem CID 11058683) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is [(4R,5E,9E)-6,10,14-trimethylpentadeca-1,5,9,13-tetraen-4-yl] (2S)-2-methoxy-2-phenylacetate.
| Compound Name | [(4R,5E,9E)-6,10,14-trimethylpentadeca-1,5,9,13-tetraen-4-yl] (2S)-2-methoxy-2-phenylacetate |
|---|---|
| PubChem CID | 11058683 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | [(4R,5E,9E)-6,10,14-trimethylpentadeca-1,5,9,13-tetraen-4-yl] (2S)-2-methoxy-2-phenylacetate |
| SMILES | C=CC[C@H](/C=C(\C)CC/C=C(\C)CCC=C(C)C)OC(=O)[C@@H](OC)c1ccccc1 |
| InChI | InChI=1S/C27H38O3/c1-7-13-25(30-27(28)26(29-6)24-18-9-8-10-19-24)20-23(5)17-12-16-22(4)15-11-14-21(2)3/h7-10,14,16,18-20,25-26H,1,11-13,15,17H2,2-6H3/b22-16+,23-20+/t25-,26+/m1/s1 |
| InChIKey | LAQCLMISSHTMMN-VQLIYGTESA-N |
| XLogP | 7.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|