C34H38O4 — CID 57137592
4-(5,9-dimethyl-2-phenyldeca-4,8-dienoyl)oxy-2,4-diphenylbutanoic acid (PubChem CID 57137592) has the molecular formula C34H38O4 and a molecular weight of 510.67 g/mol. Its IUPAC name is 4-(5,9-dimethyl-2-phenyldeca-4,8-dienoyl)oxy-2,4-diphenylbutanoic acid.
| Compound Name | 4-(5,9-dimethyl-2-phenyldeca-4,8-dienoyl)oxy-2,4-diphenylbutanoic acid |
|---|---|
| PubChem CID | 57137592 |
| Molecular Formula | C34H38O4 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | 4-(5,9-dimethyl-2-phenyldeca-4,8-dienoyl)oxy-2,4-diphenylbutanoic acid |
| SMILES | CC(C)=CCCC(C)=CCC(C(=O)OC(CC(C(=O)O)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H38O4/c1-25(2)14-13-15-26(3)22-23-30(27-16-7-4-8-17-27)34(37)38-32(29-20-11-6-12-21-29)24-31(33(35)36)28-18-9-5-10-19-28/h4-12,14,16-22,30-32H,13,15,23-24H2,1-3H3,(H,35,36) |
| InChIKey | KRYDFKMUNIWSNU-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|