C28H38O — CID 153444054
(8E)-9,13-dimethyl-4,6-diphenyltetradeca-8,12-dien-1-ol (PubChem CID 153444054) has the molecular formula C28H38O and a molecular weight of 390.61 g/mol. Its IUPAC name is (8E)-9,13-dimethyl-4,6-diphenyltetradeca-8,12-dien-1-ol.
| Compound Name | (8E)-9,13-dimethyl-4,6-diphenyltetradeca-8,12-dien-1-ol |
|---|---|
| PubChem CID | 153444054 |
| Molecular Formula | C28H38O |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | (8E)-9,13-dimethyl-4,6-diphenyltetradeca-8,12-dien-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC(CC(CCCO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H38O/c1-23(2)12-10-13-24(3)19-20-28(26-16-8-5-9-17-26)22-27(18-11-21-29)25-14-6-4-7-15-25/h4-9,12,14-17,19,27-29H,10-11,13,18,20-22H2,1-3H3/b24-19+ |
| InChIKey | IWXHXOSYQFDPLX-LYBHJNIJSA-N |
| XLogP | 7.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|