C21H27NO3 — CID 77170614
2-(1-hydroxy-6,10-dimethylundeca-5,9-dien-4-yl)isoindole-1,3-dione (PubChem CID 77170614) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-(1-hydroxy-6,10-dimethylundeca-5,9-dien-4-yl)isoindole-1,3-dione.
| Compound Name | 2-(1-hydroxy-6,10-dimethylundeca-5,9-dien-4-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 77170614 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-(1-hydroxy-6,10-dimethylundeca-5,9-dien-4-yl)isoindole-1,3-dione |
| SMILES | CC(C)=CCCC(C)=CC(CCCO)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H27NO3/c1-15(2)8-6-9-16(3)14-17(10-7-13-23)22-20(24)18-11-4-5-12-19(18)21(22)25/h4-5,8,11-12,14,17,23H,6-7,9-10,13H2,1-3H3 |
| InChIKey | MCOIJKSGRQZRMY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|