C22H26O2 — CID 70357331
[(2E)-3,7-dimethyl-1-phenoxyocta-2,6-dienoxy]benzene (PubChem CID 70357331) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is [(2E)-3,7-dimethyl-1-phenoxyocta-2,6-dienoxy]benzene.
| Compound Name | [(2E)-3,7-dimethyl-1-phenoxyocta-2,6-dienoxy]benzene |
|---|---|
| PubChem CID | 70357331 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | [(2E)-3,7-dimethyl-1-phenoxyocta-2,6-dienoxy]benzene |
| SMILES | CC(C)=CCC/C(C)=C/C(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C22H26O2/c1-18(2)11-10-12-19(3)17-22(23-20-13-6-4-7-14-20)24-21-15-8-5-9-16-21/h4-9,11,13-17,22H,10,12H2,1-3H3/b19-17+ |
| InChIKey | WIBPRSHNRNPUGY-HTXNQAPBSA-N |
| XLogP | 6.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|