C22H24N2O6 — CID 88603846
1-[(2E)-3,7-dimethyl-1-(2-nitrophenoxy)octa-2,6-dienoxy]-2-nitrobenzene (PubChem CID 88603846) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is 1-[(2E)-3,7-dimethyl-1-(2-nitrophenoxy)octa-2,6-dienoxy]-2-nitrobenzene.
| Compound Name | 1-[(2E)-3,7-dimethyl-1-(2-nitrophenoxy)octa-2,6-dienoxy]-2-nitrobenzene |
|---|---|
| PubChem CID | 88603846 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 1-[(2E)-3,7-dimethyl-1-(2-nitrophenoxy)octa-2,6-dienoxy]-2-nitrobenzene |
| SMILES | CC(C)=CCC/C(C)=C/C(Oc1ccccc1[N+](=O)[O-])Oc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H24N2O6/c1-16(2)9-8-10-17(3)15-22(29-20-13-6-4-11-18(20)23(25)26)30-21-14-7-5-12-19(21)24(27)28/h4-7,9,11-15,22H,8,10H2,1-3H3/b17-15+ |
| InChIKey | MYDJJNKFHOZSMM-BMRADRMJSA-N |
| XLogP | 5.98 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|