C26H38O3S — CID 89466477
[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl] benzenesulfonate (PubChem CID 89466477) has the molecular formula C26H38O3S and a molecular weight of 430.65 g/mol. Its IUPAC name is [(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl] benzenesulfonate.
| Compound Name | [(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl] benzenesulfonate |
|---|---|
| PubChem CID | 89466477 |
| Molecular Formula | C26H38O3S |
| Molecular Weight | 430.65 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | [(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl] benzenesulfonate |
| SMILES | CC(C)=CCC/C(C)=C/CC(/C=C(\C)CCC=C(C)C)OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H38O3S/c1-21(2)12-10-14-23(5)18-19-25(20-24(6)15-11-13-22(3)4)29-30(27,28)26-16-8-7-9-17-26/h7-9,12-13,16-18,20,25H,10-11,14-15,19H2,1-6H3/b23-18+,24-20+ |
| InChIKey | LPFNMXWLWDZASY-LWUFTARWSA-N |
| XLogP | 7.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.65 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|