C24H40O2 — CID 91575554
2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl butanoate (PubChem CID 91575554) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is 2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl butanoate.
| Compound Name | 2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl butanoate |
|---|---|
| PubChem CID | 91575554 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | 2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl butanoate |
| SMILES | CCCC(=O)OC(C=C(C)CCC=C(C)C)CC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C24H40O2/c1-8-11-24(25)26-23(18-22(7)15-10-13-20(4)5)17-16-21(6)14-9-12-19(2)3/h12-13,16,18,23H,8-11,14-15,17H2,1-7H3 |
| InChIKey | XQENHDMLGMKPLW-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|