C14H22O5 — CID 174852652
4-[(2Z)-1-hydroxy-3,7-dimethylocta-2,6-dienoxy]-4-oxobutanoic acid (PubChem CID 174852652) has the molecular formula C14H22O5 and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-[(2Z)-1-hydroxy-3,7-dimethylocta-2,6-dienoxy]-4-oxobutanoic acid.
| Compound Name | 4-[(2Z)-1-hydroxy-3,7-dimethylocta-2,6-dienoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174852652 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 4-[(2Z)-1-hydroxy-3,7-dimethylocta-2,6-dienoxy]-4-oxobutanoic acid |
| SMILES | CC(C)=CCC/C(C)=C\C(O)OC(=O)CCC(=O)O |
| InChI | InChI=1S/C14H22O5/c1-10(2)5-4-6-11(3)9-14(18)19-13(17)8-7-12(15)16/h5,9,14,18H,4,6-8H2,1-3H3,(H,15,16)/b11-9- |
| InChIKey | KOIVNXLNUOYDJD-LUAWRHEFSA-N |
| XLogP | 2.41 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|