C45H72O4 — CID 87993813
bis[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl] pentanedioate (PubChem CID 87993813) has the molecular formula C45H72O4 and a molecular weight of 677.07 g/mol. Its IUPAC name is bis[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl] pentanedioate.
| Compound Name | bis[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl] pentanedioate |
|---|---|
| PubChem CID | 87993813 |
| Molecular Formula | C45H72O4 |
| Molecular Weight | 677.07 g/mol |
| Exact Mass | 676.54 |
| IUPAC Name | bis[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl] pentanedioate |
| SMILES | CC(C)=CCC/C(C)=C/CC(/C=C(\C)CCC=C(C)C)OC(=O)CCCC(=O)OC(/C=C(\C)CCC=C(C)C)C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C45H72O4/c1-34(2)18-13-22-38(9)28-30-42(32-40(11)24-15-20-36(5)6)48-44(46)26-17-27-45(47)49-43(33-41(12)25-16-21-37(7)8)31-29-39(10)23-14-19-35(3)4/h18-21,28-29,32-33,42-43H,13-17,22-27,30-31H2,1-12H3/b38-28+,39-29+,40-32+,41-33+ |
| InChIKey | GMOZPGSQUIDCRL-LTAJOZCJSA-N |
| XLogP | 13.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.07 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|