C21H32O4 — CID 139899689
[(2E)-1-hydroxy-3,7-dimethylocta-2,6-dienyl] (3E)-4,8-dimethyl-2-oxonona-3,7-dienoate (PubChem CID 139899689) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is [(2E)-1-hydroxy-3,7-dimethylocta-2,6-dienyl] (3E)-4,8-dimethyl-2-oxonona-3,7-dienoate.
| Compound Name | [(2E)-1-hydroxy-3,7-dimethylocta-2,6-dienyl] (3E)-4,8-dimethyl-2-oxonona-3,7-dienoate |
|---|---|
| PubChem CID | 139899689 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | [(2E)-1-hydroxy-3,7-dimethylocta-2,6-dienyl] (3E)-4,8-dimethyl-2-oxonona-3,7-dienoate |
| SMILES | CC(C)=CCC/C(C)=C/C(=O)C(=O)OC(O)/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C21H32O4/c1-15(2)9-7-11-17(5)13-19(22)21(24)25-20(23)14-18(6)12-8-10-16(3)4/h9-10,13-14,20,23H,7-8,11-12H2,1-6H3/b17-13+,18-14+ |
| InChIKey | LOFAYETZCYLEHQ-HBKJEHTGSA-N |
| XLogP | 4.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|