C15H26O4P+ — CID 88942982
hydroxy-[(2E,6E)-1-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienoxy]-oxophosphanium (PubChem CID 88942982) has the molecular formula C15H26O4P+ and a molecular weight of 301.34 g/mol. Its IUPAC name is hydroxy-[(2E,6E)-1-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienoxy]-oxophosphanium.
| Compound Name | hydroxy-[(2E,6E)-1-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienoxy]-oxophosphanium |
|---|---|
| PubChem CID | 88942982 |
| Molecular Formula | C15H26O4P+ |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | hydroxy-[(2E,6E)-1-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienoxy]-oxophosphanium |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(O)O[P+](=O)O |
| InChI | InChI=1S/C15H25O4P/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(16)19-20(17)18/h7,9,11,15-16H,5-6,8,10H2,1-4H3/p+1/b13-9+,14-11+ |
| InChIKey | HEISBYBPWGHVIA-IJFRVEDASA-O |
| XLogP | 4.39 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|