C32H54O5P+ — CID 22914190
bis[(3E,7E)-2-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienoxy]-oxophosphanium (PubChem CID 22914190) has the molecular formula C32H54O5P+ and a molecular weight of 549.75 g/mol. Its IUPAC name is bis[(3E,7E)-2-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienoxy]-oxophosphanium.
| Compound Name | bis[(3E,7E)-2-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienoxy]-oxophosphanium |
|---|---|
| PubChem CID | 22914190 |
| Molecular Formula | C32H54O5P+ |
| Molecular Weight | 549.75 g/mol |
| Exact Mass | 549.37 |
| IUPAC Name | bis[(3E,7E)-2-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienoxy]-oxophosphanium |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(O)CO[P+](=O)OCC(O)/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C32H54O5P/c1-25(2)13-9-15-27(5)17-11-19-29(7)21-31(33)23-36-38(35)37-24-32(34)22-30(8)20-12-18-28(6)16-10-14-26(3)4/h13-14,17-18,21-22,31-34H,9-12,15-16,19-20,23-24H2,1-8H3/q+1/b27-17+,28-18+,29-21+,30-22+ |
| InChIKey | QGFNSAIVYDTVQA-SBEKHEBASA-N |
| XLogP | 9.24 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.75 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|