C19H26O2S — CID 58409827
[(2Z,5E)-6,10-dimethylundeca-2,5,9-trien-3-yl]sulfonylbenzene (PubChem CID 58409827) has the molecular formula C19H26O2S and a molecular weight of 318.48 g/mol. Its IUPAC name is [(2Z,5E)-6,10-dimethylundeca-2,5,9-trien-3-yl]sulfonylbenzene.
| Compound Name | [(2Z,5E)-6,10-dimethylundeca-2,5,9-trien-3-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 58409827 |
| Molecular Formula | C19H26O2S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | [(2Z,5E)-6,10-dimethylundeca-2,5,9-trien-3-yl]sulfonylbenzene |
| SMILES | C/C=C(/C/C=C(\C)CCC=C(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H26O2S/c1-5-18(15-14-17(4)11-9-10-16(2)3)22(20,21)19-12-7-6-8-13-19/h5-8,10,12-14H,9,11,15H2,1-4H3/b17-14+,18-5- |
| InChIKey | XMWMWPHOKFAWOC-BNVOZXBRSA-N |
| XLogP | 5.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|