C32H42O4S2 — CID 141048309
[(6E,10E,14E)-8-(benzenesulfonyl)-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]sulfonylbenzene (PubChem CID 141048309) has the molecular formula C32H42O4S2 and a molecular weight of 554.82 g/mol. Its IUPAC name is [(6E,10E,14E)-8-(benzenesulfonyl)-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]sulfonylbenzene.
| Compound Name | [(6E,10E,14E)-8-(benzenesulfonyl)-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 141048309 |
| Molecular Formula | C32H42O4S2 |
| Molecular Weight | 554.82 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | [(6E,10E,14E)-8-(benzenesulfonyl)-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]sulfonylbenzene |
| SMILES | C/C=C(\C)CC/C=C(\C)CC(/C=C(\C)CCC=C(C)C)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H42O4S2/c1-7-27(4)17-15-19-29(6)25-32(24-28(5)18-14-16-26(2)3,37(33,34)30-20-10-8-11-21-30)38(35,36)31-22-12-9-13-23-31/h7-13,16,19-24H,14-15,17-18,25H2,1-6H3/b27-7+,28-24+,29-19+ |
| InChIKey | PFCLVAZKDPZCMX-PWBJOKKRSA-N |
| XLogP | 8.41 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.82 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|