C16H21BrO2S — CID 171422851
[(2E,6E)-8-bromo-2,6-dimethylocta-2,6-dienyl]sulfonylbenzene (PubChem CID 171422851) has the molecular formula C16H21BrO2S and a molecular weight of 357.31 g/mol. Its IUPAC name is [(2E,6E)-8-bromo-2,6-dimethylocta-2,6-dienyl]sulfonylbenzene.
| Compound Name | [(2E,6E)-8-bromo-2,6-dimethylocta-2,6-dienyl]sulfonylbenzene |
|---|---|
| PubChem CID | 171422851 |
| Molecular Formula | C16H21BrO2S |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | [(2E,6E)-8-bromo-2,6-dimethylocta-2,6-dienyl]sulfonylbenzene |
| SMILES | C/C(=C\CBr)CC/C=C(\C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H21BrO2S/c1-14(11-12-17)7-6-8-15(2)13-20(18,19)16-9-4-3-5-10-16/h3-5,8-11H,6-7,12-13H2,1-2H3/b14-11+,15-8+ |
| InChIKey | VMRMVXYWHPODOU-GGQZXFEVSA-N |
| XLogP | 4.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|