C22H28O6S — CID 53428027
1-[4-(benzenesulfonyl)-3-methylbut-2-enyl]-2,3,4,5-tetramethoxy-6-methylbenzene (PubChem CID 53428027) has the molecular formula C22H28O6S and a molecular weight of 420.53 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)-3-methylbut-2-enyl]-2,3,4,5-tetramethoxy-6-methylbenzene.
| Compound Name | 1-[4-(benzenesulfonyl)-3-methylbut-2-enyl]-2,3,4,5-tetramethoxy-6-methylbenzene |
|---|---|
| PubChem CID | 53428027 |
| Molecular Formula | C22H28O6S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 1-[4-(benzenesulfonyl)-3-methylbut-2-enyl]-2,3,4,5-tetramethoxy-6-methylbenzene |
| SMILES | COc1c(C)c(CC=C(C)CS(=O)(=O)c2ccccc2)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C22H28O6S/c1-15(14-29(23,24)17-10-8-7-9-11-17)12-13-18-16(2)19(25-3)21(27-5)22(28-6)20(18)26-4/h7-12H,13-14H2,1-6H3 |
| InChIKey | TVWDMEPMXPWDAP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|