C23H32O4 — CID 70594960
(E)-8-(1,4-dimethoxy-3-methylnaphthalen-2-yl)-2,6-dimethyloct-6-ene-2,3-diol (PubChem CID 70594960) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is (E)-8-(1,4-dimethoxy-3-methylnaphthalen-2-yl)-2,6-dimethyloct-6-ene-2,3-diol.
| Compound Name | (E)-8-(1,4-dimethoxy-3-methylnaphthalen-2-yl)-2,6-dimethyloct-6-ene-2,3-diol |
|---|---|
| PubChem CID | 70594960 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (E)-8-(1,4-dimethoxy-3-methylnaphthalen-2-yl)-2,6-dimethyloct-6-ene-2,3-diol |
| SMILES | COc1c(C)c(C/C=C(\C)CCC(O)C(C)(C)O)c(OC)c2ccccc12 |
| InChI | InChI=1S/C23H32O4/c1-15(12-14-20(24)23(3,4)25)11-13-17-16(2)21(26-5)18-9-7-8-10-19(18)22(17)27-6/h7-11,20,24-25H,12-14H2,1-6H3/b15-11+ |
| InChIKey | WELWQXGTKMIQBR-RVDMUPIBSA-N |
| XLogP | 4.57 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|