C25H30O6 — CID 162842717
8-[4-hydroxy-2-(6-hydroxy-1-benzofuran-2-yl)-6-methoxyphenyl]-2,6-dimethyloct-6-ene-2,3-diol (PubChem CID 162842717) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is 8-[4-hydroxy-2-(6-hydroxy-1-benzofuran-2-yl)-6-methoxyphenyl]-2,6-dimethyloct-6-ene-2,3-diol.
| Compound Name | 8-[4-hydroxy-2-(6-hydroxy-1-benzofuran-2-yl)-6-methoxyphenyl]-2,6-dimethyloct-6-ene-2,3-diol |
|---|---|
| PubChem CID | 162842717 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 8-[4-hydroxy-2-(6-hydroxy-1-benzofuran-2-yl)-6-methoxyphenyl]-2,6-dimethyloct-6-ene-2,3-diol |
| SMILES | COc1cc(O)cc(-c2cc3ccc(O)cc3o2)c1CC=C(C)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C25H30O6/c1-15(6-10-24(28)25(2,3)29)5-9-19-20(12-18(27)14-22(19)30-4)23-11-16-7-8-17(26)13-21(16)31-23/h5,7-8,11-14,24,26-29H,6,9-10H2,1-4H3 |
| InChIKey | XPAFKAREYVZGQS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|