C24H26O5 — CID 162917436
2-[5-hydroxy-3-methoxy-2-[[3-(4-methylpent-3-enyl)oxiran-2-yl]methyl]phenyl]-1-benzofuran-6-ol (PubChem CID 162917436) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-[5-hydroxy-3-methoxy-2-[[3-(4-methylpent-3-enyl)oxiran-2-yl]methyl]phenyl]-1-benzofuran-6-ol.
| Compound Name | 2-[5-hydroxy-3-methoxy-2-[[3-(4-methylpent-3-enyl)oxiran-2-yl]methyl]phenyl]-1-benzofuran-6-ol |
|---|---|
| PubChem CID | 162917436 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2-[5-hydroxy-3-methoxy-2-[[3-(4-methylpent-3-enyl)oxiran-2-yl]methyl]phenyl]-1-benzofuran-6-ol |
| SMILES | COc1cc(O)cc(-c2cc3ccc(O)cc3o2)c1CC1OC1CCC=C(C)C |
| InChI | InChI=1S/C24H26O5/c1-14(2)5-4-6-20-24(28-20)13-19-18(10-17(26)12-22(19)27-3)23-9-15-7-8-16(25)11-21(15)29-23/h5,7-12,20,24-26H,4,6,13H2,1-3H3 |
| InChIKey | FUWSKQFUXJQBSO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|