C29H34O4 — CID 162924996
2-(3,7-dimethylocta-2,6-dienyl)-5-(6-hydroxy-1-benzofuran-2-yl)-4-(3-methylbut-2-enyl)benzene-1,3-diol (PubChem CID 162924996) has the molecular formula C29H34O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-2,6-dienyl)-5-(6-hydroxy-1-benzofuran-2-yl)-4-(3-methylbut-2-enyl)benzene-1,3-diol.
| Compound Name | 2-(3,7-dimethylocta-2,6-dienyl)-5-(6-hydroxy-1-benzofuran-2-yl)-4-(3-methylbut-2-enyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 162924996 |
| Molecular Formula | C29H34O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 2-(3,7-dimethylocta-2,6-dienyl)-5-(6-hydroxy-1-benzofuran-2-yl)-4-(3-methylbut-2-enyl)benzene-1,3-diol |
| SMILES | CC(C)=CCCC(C)=CCc1c(O)cc(-c2cc3ccc(O)cc3o2)c(CC=C(C)C)c1O |
| InChI | InChI=1S/C29H34O4/c1-18(2)7-6-8-20(5)10-14-24-26(31)17-25(23(29(24)32)13-9-19(3)4)28-15-21-11-12-22(30)16-27(21)33-28/h7,9-12,15-17,30-32H,6,8,13-14H2,1-5H3 |
| InChIKey | DXPXODNTDYQKTG-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|