C23H31BrO3 — CID 57132080
3-bromo-8-(1,4-dimethoxy-3-methylnaphthalen-2-yl)-2,6-dimethyloct-6-en-2-ol (PubChem CID 57132080) has the molecular formula C23H31BrO3 and a molecular weight of 435.40 g/mol. Its IUPAC name is 3-bromo-8-(1,4-dimethoxy-3-methylnaphthalen-2-yl)-2,6-dimethyloct-6-en-2-ol.
| Compound Name | 3-bromo-8-(1,4-dimethoxy-3-methylnaphthalen-2-yl)-2,6-dimethyloct-6-en-2-ol |
|---|---|
| PubChem CID | 57132080 |
| Molecular Formula | C23H31BrO3 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 3-bromo-8-(1,4-dimethoxy-3-methylnaphthalen-2-yl)-2,6-dimethyloct-6-en-2-ol |
| SMILES | COc1c(C)c(CC=C(C)CCC(Br)C(C)(C)O)c(OC)c2ccccc12 |
| InChI | InChI=1S/C23H31BrO3/c1-15(12-14-20(24)23(3,4)25)11-13-17-16(2)21(26-5)18-9-7-8-10-19(18)22(17)27-6/h7-11,20,25H,12-14H2,1-6H3 |
| InChIKey | UHCSLRFCMRIZKW-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|