C33H52O2 — CID 118053661
1,4-dimethoxy-2-methyl-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene (PubChem CID 118053661) has the molecular formula C33H52O2 and a molecular weight of 480.78 g/mol. Its IUPAC name is 1,4-dimethoxy-2-methyl-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene.
| Compound Name | 1,4-dimethoxy-2-methyl-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene |
|---|---|
| PubChem CID | 118053661 |
| Molecular Formula | C33H52O2 |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 480.40 |
| IUPAC Name | 1,4-dimethoxy-2-methyl-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene |
| SMILES | COc1c(C)c(C/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)c(OC)c2ccccc12 |
| InChI | InChI=1S/C33H52O2/c1-24(2)14-11-15-25(3)16-12-17-26(4)18-13-19-27(5)22-23-29-28(6)32(34-7)30-20-9-10-21-31(30)33(29)35-8/h9-10,20-22,24-26H,11-19,23H2,1-8H3/b27-22+/t25-,26-/m1/s1 |
| InChIKey | KSMNGEPNRHMKHQ-LGWQWDGZSA-N |
| XLogP | 10.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|