C31H52O3 — CID 10434967
[4-hydroxy-2,3,6-trimethyl-5-[(Z,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]phenyl] acetate (PubChem CID 10434967) has the molecular formula C31H52O3 and a molecular weight of 472.75 g/mol. Its IUPAC name is [4-hydroxy-2,3,6-trimethyl-5-[(Z,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]phenyl] acetate.
| Compound Name | [4-hydroxy-2,3,6-trimethyl-5-[(Z,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 10434967 |
| Molecular Formula | C31H52O3 |
| Molecular Weight | 472.75 g/mol |
| Exact Mass | 472.39 |
| IUPAC Name | [4-hydroxy-2,3,6-trimethyl-5-[(Z,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]phenyl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C)c(O)c(C/C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)c1C |
| InChI | InChI=1S/C31H52O3/c1-21(2)13-10-14-22(3)15-11-16-23(4)17-12-18-24(5)19-20-29-27(8)31(34-28(9)32)26(7)25(6)30(29)33/h19,21-23,33H,10-18,20H2,1-9H3/b24-19-/t22-,23-/m1/s1 |
| InChIKey | GEFRVSVMVFLHNE-AUPDVOIUSA-N |
| XLogP | 9.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.75 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|