C35H48O5Si — CID 124629299
tert-butyl-[(Z)-5-methyl-7-(2,3,4,5-tetramethoxy-6-methylphenyl)hept-5-enoxy]-diphenylsilane (PubChem CID 124629299) has the molecular formula C35H48O5Si and a molecular weight of 576.85 g/mol. Its IUPAC name is tert-butyl-[(Z)-5-methyl-7-(2,3,4,5-tetramethoxy-6-methylphenyl)hept-5-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(Z)-5-methyl-7-(2,3,4,5-tetramethoxy-6-methylphenyl)hept-5-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 124629299 |
| Molecular Formula | C35H48O5Si |
| Molecular Weight | 576.85 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | tert-butyl-[(Z)-5-methyl-7-(2,3,4,5-tetramethoxy-6-methylphenyl)hept-5-enoxy]-diphenylsilane |
| SMILES | COc1c(C)c(C/C=C(/C)CCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C35H48O5Si/c1-26(23-24-30-27(2)31(36-6)33(38-8)34(39-9)32(30)37-7)18-16-17-25-40-41(35(3,4)5,28-19-12-10-13-20-28)29-21-14-11-15-22-29/h10-15,19-23H,16-18,24-25H2,1-9H3/b26-23- |
| InChIKey | YHKKAQITXCIVCO-RWEWTDSWSA-N |
| XLogP | 7.27 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.85 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|