C31H37NO2Si — CID 15355701
tert-butyl-[(E)-7-furo[2,3-b]pyridin-5-yl-5-methylhept-5-enoxy]-diphenylsilane (PubChem CID 15355701) has the molecular formula C31H37NO2Si and a molecular weight of 483.73 g/mol. Its IUPAC name is tert-butyl-[(E)-7-furo[2,3-b]pyridin-5-yl-5-methylhept-5-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E)-7-furo[2,3-b]pyridin-5-yl-5-methylhept-5-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 15355701 |
| Molecular Formula | C31H37NO2Si |
| Molecular Weight | 483.73 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | tert-butyl-[(E)-7-furo[2,3-b]pyridin-5-yl-5-methylhept-5-enoxy]-diphenylsilane |
| SMILES | C/C(=C\Cc1cnc2occc2c1)CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H37NO2Si/c1-25(18-19-26-23-27-20-22-33-30(27)32-24-26)13-11-12-21-34-35(31(2,3)4,28-14-7-5-8-15-28)29-16-9-6-10-17-29/h5-10,14-18,20,22-24H,11-13,19,21H2,1-4H3/b25-18+ |
| InChIKey | YVDQUFIUCGNEGN-XIEYBQDHSA-N |
| XLogP | 7.06 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.73 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|