C21H33F3OSi — CID 12965438
tert-butyl-dimethyl-[(E)-5-methyl-7-[3-(trifluoromethyl)phenyl]hept-5-enoxy]silane (PubChem CID 12965438) has the molecular formula C21H33F3OSi and a molecular weight of 386.57 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-5-methyl-7-[3-(trifluoromethyl)phenyl]hept-5-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-5-methyl-7-[3-(trifluoromethyl)phenyl]hept-5-enoxy]silane |
|---|---|
| PubChem CID | 12965438 |
| Molecular Formula | C21H33F3OSi |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-5-methyl-7-[3-(trifluoromethyl)phenyl]hept-5-enoxy]silane |
| SMILES | C/C(=C\Cc1cccc(C(F)(F)F)c1)CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H33F3OSi/c1-17(10-7-8-15-25-26(5,6)20(2,3)4)13-14-18-11-9-12-19(16-18)21(22,23)24/h9,11-13,16H,7-8,10,14-15H2,1-6H3/b17-13+ |
| InChIKey | PYKVVTOPQMWEPN-GHRIWEEISA-N |
| XLogP | 7.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|