About 2-bromoethoxy-tert-butyl-dimethylsilane;1-methyl-3-(trifluoromethyl)benzene
2-bromoethoxy-tert-butyl-dimethylsilane;1-methyl-3-(trifluoromethyl)benzene (PubChem CID 162014884) has the molecular formula C16H26BrF3OSi
and a molecular weight of 399.37 g/mol. Its IUPAC name is 2-bromoethoxy-tert-butyl-dimethylsilane;1-methyl-3-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 2-bromoethoxy-tert-butyl-dimethylsilane;1-methyl-3-(trifluoromethyl)benzene |
| PubChem CID | 162014884 |
| Molecular Formula | C16H26BrF3OSi |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-bromoethoxy-tert-butyl-dimethylsilane;1-methyl-3-(trifluoromethyl)benzene |
| SMILES | CC(C)(C)[Si](C)(C)OCCBr.Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H19BrOSi.C8H7F3/c1-8(2,3)11(4,5)10-7-6-9;1-6-3-2-4-7(5-6)8(9,10)11/h6-7H2,1-5H3;2-5H,1H3 |
| InChIKey | YTYXQRJBAJOZNE-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoethoxy-tert-butyl-dimethylsilane;1-methyl-3-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoethoxy-tert-butyl-dimethylsilane;1-methyl-3-(trifluoromethyl)benzene?
The IUPAC name of 2-bromoethoxy-tert-butyl-dimethylsilane;1-methyl-3-(trifluoromethyl)benzene (CID 162014884) is 2-bromoethoxy-tert-butyl-dimethylsilane;1-methyl-3-(trifluoromethyl)benzene.
What is the SMILES notation for 2-bromoethoxy-tert-butyl-dimethylsilane;1-methyl-3-(trifluoromethyl)benzene?
The canonical SMILES for 2-bromoethoxy-tert-butyl-dimethylsilane;1-methyl-3-(trifluoromethyl)benzene is CC(C)(C)[Si](C)(C)OCCBr.Cc1cccc(C(F)(F)F)c1.
What is the InChIKey of 2-bromoethoxy-tert-butyl-dimethylsilane;1-methyl-3-(trifluoromethyl)benzene?
The InChIKey is YTYXQRJBAJOZNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19BrOSi.C8H7F3/c1-8(2,3)11(4,5)10-7-6-9;1-6-3-2-4-7(5-6)8(9,10)11/h6-7H2,1-5H3;2-5H,1H3.
What are the key properties of 2-bromoethoxy-tert-butyl-dimethylsilane;1-methyl-3-(trifluoromethyl)benzene?
2-bromoethoxy-tert-butyl-dimethylsilane;1-methyl-3-(trifluoromethyl)benzene has a molecular weight of 399.37 g/mol, XLogP of 6.42, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoethoxy-tert-butyl-dimethylsilane;1-methyl-3-(trifluoromethyl)benzene is sourced from PubChem (CID 162014884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).