C22H28BrF3O2Si — CID 140866774
1-[4-bromo-3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-1-[3-(trifluoromethyl)phenyl]ethanol (PubChem CID 140866774) has the molecular formula C22H28BrF3O2Si and a molecular weight of 489.45 g/mol. Its IUPAC name is 1-[4-bromo-3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-1-[3-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 1-[4-bromo-3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-1-[3-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 140866774 |
| Molecular Formula | C22H28BrF3O2Si |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 1-[4-bromo-3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-1-[3-(trifluoromethyl)phenyl]ethanol |
| SMILES | CC(O)(c1cccc(C(F)(F)F)c1)c1ccc(Br)c(CO[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C22H28BrF3O2Si/c1-20(2,3)29(5,6)28-14-15-12-17(10-11-19(15)23)21(4,27)16-8-7-9-18(13-16)22(24,25)26/h7-13,27H,14H2,1-6H3 |
| InChIKey | SXEKCIMQJACCIZ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|