C20H31F3O2Si — CID 58968632
[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethyl)phenyl]-cyclopentylmethanol (PubChem CID 58968632) has the molecular formula C20H31F3O2Si and a molecular weight of 388.55 g/mol. Its IUPAC name is [2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethyl)phenyl]-cyclopentylmethanol.
| Compound Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethyl)phenyl]-cyclopentylmethanol |
|---|---|
| PubChem CID | 58968632 |
| Molecular Formula | C20H31F3O2Si |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethyl)phenyl]-cyclopentylmethanol |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(C(F)(F)F)ccc1C(O)C1CCCC1 |
| InChI | InChI=1S/C20H31F3O2Si/c1-19(2,3)26(4,5)25-13-15-12-16(20(21,22)23)10-11-17(15)18(24)14-8-6-7-9-14/h10-12,14,18,24H,6-9,13H2,1-5H3 |
| InChIKey | QEKBLDKZFGDXAS-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|