C12H10F6O — CID 139965713
[2,4-bis(trifluoromethyl)phenyl]-cyclopropylmethanol (PubChem CID 139965713) has the molecular formula C12H10F6O and a molecular weight of 284.20 g/mol. Its IUPAC name is [2,4-bis(trifluoromethyl)phenyl]-cyclopropylmethanol.
| Compound Name | [2,4-bis(trifluoromethyl)phenyl]-cyclopropylmethanol |
|---|---|
| PubChem CID | 139965713 |
| Molecular Formula | C12H10F6O |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | [2,4-bis(trifluoromethyl)phenyl]-cyclopropylmethanol |
| SMILES | OC(c1ccc(C(F)(F)F)cc1C(F)(F)F)C1CC1 |
| InChI | InChI=1S/C12H10F6O/c13-11(14,15)7-3-4-8(10(19)6-1-2-6)9(5-7)12(16,17)18/h3-6,10,19H,1-2H2 |
| InChIKey | AKWBTFMTASCHBP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |