C15H9ClF6O — CID 54576991
[2,4-bis(trifluoromethyl)phenyl]-(4-chlorophenyl)methanol (PubChem CID 54576991) has the molecular formula C15H9ClF6O and a molecular weight of 354.68 g/mol. Its IUPAC name is [2,4-bis(trifluoromethyl)phenyl]-(4-chlorophenyl)methanol.
| Compound Name | [2,4-bis(trifluoromethyl)phenyl]-(4-chlorophenyl)methanol |
|---|---|
| PubChem CID | 54576991 |
| Molecular Formula | C15H9ClF6O |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | [2,4-bis(trifluoromethyl)phenyl]-(4-chlorophenyl)methanol |
| SMILES | OC(c1ccc(Cl)cc1)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C15H9ClF6O/c16-10-4-1-8(2-5-10)13(23)11-6-3-9(14(17,18)19)7-12(11)15(20,21)22/h1-7,13,23H |
| InChIKey | OWCQTDOBHGSSID-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |