C16H19F3O — CID 102759206
7-bicyclo[4.1.0]heptanyl-[2-methyl-4-(trifluoromethyl)phenyl]methanol (PubChem CID 102759206) has the molecular formula C16H19F3O and a molecular weight of 284.32 g/mol. Its IUPAC name is 7-bicyclo[4.1.0]heptanyl-[2-methyl-4-(trifluoromethyl)phenyl]methanol.
| Compound Name | 7-bicyclo[4.1.0]heptanyl-[2-methyl-4-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 102759206 |
| Molecular Formula | C16H19F3O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 7-bicyclo[4.1.0]heptanyl-[2-methyl-4-(trifluoromethyl)phenyl]methanol |
| SMILES | Cc1cc(C(F)(F)F)ccc1C(O)C1C2CCCCC21 |
| InChI | InChI=1S/C16H19F3O/c1-9-8-10(16(17,18)19)6-7-11(9)15(20)14-12-4-2-3-5-13(12)14/h6-8,12-15,20H,2-5H2,1H3 |
| InChIKey | VJBDAMLWSGLUEV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |