C17H21F3O — CID 103277723
(3,5-dimethylcyclohex-3-en-1-yl)-[2-methyl-4-(trifluoromethyl)phenyl]methanol (PubChem CID 103277723) has the molecular formula C17H21F3O and a molecular weight of 298.35 g/mol. Its IUPAC name is (3,5-dimethylcyclohex-3-en-1-yl)-[2-methyl-4-(trifluoromethyl)phenyl]methanol.
| Compound Name | (3,5-dimethylcyclohex-3-en-1-yl)-[2-methyl-4-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 103277723 |
| Molecular Formula | C17H21F3O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (3,5-dimethylcyclohex-3-en-1-yl)-[2-methyl-4-(trifluoromethyl)phenyl]methanol |
| SMILES | CC1=CC(C)CC(C(O)c2ccc(C(F)(F)F)cc2C)C1 |
| InChI | InChI=1S/C17H21F3O/c1-10-6-11(2)8-13(7-10)16(21)15-5-4-14(9-12(15)3)17(18,19)20/h4-6,9-10,13,16,21H,7-8H2,1-3H3 |
| InChIKey | PHERAEPZTYBZGG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|