C16H22O — CID 115806982
6-bicyclo[3.1.0]hexanyl-(2,4,5-trimethylphenyl)methanol (PubChem CID 115806982) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 6-bicyclo[3.1.0]hexanyl-(2,4,5-trimethylphenyl)methanol.
| Compound Name | 6-bicyclo[3.1.0]hexanyl-(2,4,5-trimethylphenyl)methanol |
|---|---|
| PubChem CID | 115806982 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 6-bicyclo[3.1.0]hexanyl-(2,4,5-trimethylphenyl)methanol |
| SMILES | Cc1cc(C)c(C(O)C2C3CCCC32)cc1C |
| InChI | InChI=1S/C16H22O/c1-9-7-11(3)14(8-10(9)2)16(17)15-12-5-4-6-13(12)15/h7-8,12-13,15-17H,4-6H2,1-3H3 |
| InChIKey | BAEAHANDQHKFSF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |