C15H23NO — CID 80503850
piperidin-4-yl-(2,4,5-trimethylphenyl)methanol (PubChem CID 80503850) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is piperidin-4-yl-(2,4,5-trimethylphenyl)methanol.
| Compound Name | piperidin-4-yl-(2,4,5-trimethylphenyl)methanol |
|---|---|
| PubChem CID | 80503850 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | piperidin-4-yl-(2,4,5-trimethylphenyl)methanol |
| SMILES | Cc1cc(C)c(C(O)C2CCNCC2)cc1C |
| InChI | InChI=1S/C15H23NO/c1-10-8-12(3)14(9-11(10)2)15(17)13-4-6-16-7-5-13/h8-9,13,15-17H,4-7H2,1-3H3 |
| InChIKey | LJDPNCOIVCUDKO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |