About 4-ethylphenol;1-methyl-3-(trifluoromethyl)benzene
4-ethylphenol;1-methyl-3-(trifluoromethyl)benzene (PubChem CID 160700624) has the molecular formula C16H17F3O
and a molecular weight of 282.31 g/mol. Its IUPAC name is 4-ethylphenol;1-methyl-3-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 4-ethylphenol;1-methyl-3-(trifluoromethyl)benzene |
| PubChem CID | 160700624 |
| Molecular Formula | C16H17F3O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-ethylphenol;1-methyl-3-(trifluoromethyl)benzene |
| SMILES | CCc1ccc(O)cc1.Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H7F3.C8H10O/c1-6-3-2-4-7(5-6)8(9,10)11;1-2-7-3-5-8(9)6-4-7/h2-5H,1H3;3-6,9H,2H2,1H3 |
| InChIKey | RQOLHNGQOWKKKO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethylphenol;1-methyl-3-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylphenol;1-methyl-3-(trifluoromethyl)benzene?
The IUPAC name of 4-ethylphenol;1-methyl-3-(trifluoromethyl)benzene (CID 160700624) is 4-ethylphenol;1-methyl-3-(trifluoromethyl)benzene.
What is the SMILES notation for 4-ethylphenol;1-methyl-3-(trifluoromethyl)benzene?
The canonical SMILES for 4-ethylphenol;1-methyl-3-(trifluoromethyl)benzene is CCc1ccc(O)cc1.Cc1cccc(C(F)(F)F)c1.
What is the InChIKey of 4-ethylphenol;1-methyl-3-(trifluoromethyl)benzene?
The InChIKey is RQOLHNGQOWKKKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3.C8H10O/c1-6-3-2-4-7(5-6)8(9,10)11;1-2-7-3-5-8(9)6-4-7/h2-5H,1H3;3-6,9H,2H2,1H3.
What are the key properties of 4-ethylphenol;1-methyl-3-(trifluoromethyl)benzene?
4-ethylphenol;1-methyl-3-(trifluoromethyl)benzene has a molecular weight of 282.31 g/mol, XLogP of 4.97, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylphenol;1-methyl-3-(trifluoromethyl)benzene is sourced from PubChem (CID 160700624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).