C16H25BrF4OSi — CID 157158193
2-bromoethoxy-tert-butyl-dimethylsilane;1-fluoro-4-methyl-2-(trifluoromethyl)benzene (PubChem CID 157158193) has the molecular formula C16H25BrF4OSi and a molecular weight of 417.36 g/mol. Its IUPAC name is 2-bromoethoxy-tert-butyl-dimethylsilane;1-fluoro-4-methyl-2-(trifluoromethyl)benzene.
| Compound Name | 2-bromoethoxy-tert-butyl-dimethylsilane;1-fluoro-4-methyl-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 157158193 |
| Molecular Formula | C16H25BrF4OSi |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 2-bromoethoxy-tert-butyl-dimethylsilane;1-fluoro-4-methyl-2-(trifluoromethyl)benzene |
| SMILES | CC(C)(C)[Si](C)(C)OCCBr.Cc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H19BrOSi.C8H6F4/c1-8(2,3)11(4,5)10-7-6-9;1-5-2-3-7(9)6(4-5)8(10,11)12/h6-7H2,1-5H3;2-4H,1H3 |
| InChIKey | AMBDXEKJTMXUDA-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|