C15H21BrF4OSi — CID 169498256
[2-bromo-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethoxy]-tert-butyl-dimethylsilane (PubChem CID 169498256) has the molecular formula C15H21BrF4OSi and a molecular weight of 401.31 g/mol. Its IUPAC name is [2-bromo-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethoxy]-tert-butyl-dimethylsilane.
| Compound Name | [2-bromo-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 169498256 |
| Molecular Formula | C15H21BrF4OSi |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | [2-bromo-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(CBr)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H21BrF4OSi/c1-14(2,3)22(4,5)21-13(9-16)10-6-7-12(17)11(8-10)15(18,19)20/h6-8,13H,9H2,1-5H3 |
| InChIKey | WMWWOQBVMUHYPE-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|