C20H39NO2Si2 — CID 91743544
2-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethanamine (PubChem CID 91743544) has the molecular formula C20H39NO2Si2 and a molecular weight of 381.71 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethanamine.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethanamine |
|---|---|
| PubChem CID | 91743544 |
| Molecular Formula | C20H39NO2Si2 |
| Molecular Weight | 381.71 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethanamine |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C(CN)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H39NO2Si2/c1-19(2,3)24(7,8)22-17-13-11-16(12-14-17)18(15-21)23-25(9,10)20(4,5)6/h11-14,18H,15,21H2,1-10H3 |
| InChIKey | XBWBCZSENFXJSF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.71 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|