C16H27Cl2NO2Si — CID 70110091
1-amino-4-[tert-butyl(dimethyl)silyl]oxy-4-(3,4-dichlorophenyl)butan-2-ol (PubChem CID 70110091) has the molecular formula C16H27Cl2NO2Si and a molecular weight of 364.39 g/mol. Its IUPAC name is 1-amino-4-[tert-butyl(dimethyl)silyl]oxy-4-(3,4-dichlorophenyl)butan-2-ol.
| Compound Name | 1-amino-4-[tert-butyl(dimethyl)silyl]oxy-4-(3,4-dichlorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 70110091 |
| Molecular Formula | C16H27Cl2NO2Si |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-amino-4-[tert-butyl(dimethyl)silyl]oxy-4-(3,4-dichlorophenyl)butan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC(CC(O)CN)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H27Cl2NO2Si/c1-16(2,3)22(4,5)21-15(9-12(20)10-19)11-6-7-13(17)14(18)8-11/h6-8,12,15,20H,9-10,19H2,1-5H3 |
| InChIKey | JTWJBVBTNFJPTJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|